C16H24ClN5O9P2 — CID 130205871
[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130205871) has the molecular formula C16H24ClN5O9P2 and a molecular weight of 527.80 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130205871 |
| Molecular Formula | C16H24ClN5O9P2 |
| Molecular Weight | 527.80 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H24ClN5O9P2/c17-16-20-13(19-8-3-1-2-4-8)9-5-18-22(14(9)21-16)15-12(24)11(23)10(31-15)6-30-33(28,29)7-32(25,26)27/h5,8,10-12,15,23-24H,1-4,6-7H2,(H,28,29)(H,19,20,21)(H2,25,26,27)/t10-,11-,12-,15-/m1/s1 |
| InChIKey | NFTWTQKEWHLKFB-RTWAVKEYSA-N |
| XLogP | 0.79 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.80 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|