About 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine
6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine (PubChem CID 130205878) has the molecular formula C12H19F2N5O3
and a molecular weight of 319.31 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine.
Molecular Properties
| Compound Name | 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine |
| PubChem CID | 130205878 |
| Molecular Formula | C12H19F2N5O3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine |
| SMILES | CN(C)CCN(C)c1nc(OCC(F)F)c([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C12H19F2N5O3/c1-17(2)4-5-18(3)11-8(15)6-9(19(20)21)12(16-11)22-7-10(13)14/h6,10H,4-5,7,15H2,1-3H3 |
| InChIKey | MKDKJPOSPGHBBJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine?
The IUPAC name of 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine (CID 130205878) is 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine.
What is the SMILES notation for 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine?
The canonical SMILES for 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine is CN(C)CCN(C)c1nc(OCC(F)F)c([N+](=O)[O-])cc1N.
What is the InChIKey of 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine?
The InChIKey is MKDKJPOSPGHBBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N5O3/c1-17(2)4-5-18(3)11-8(15)6-9(19(20)21)12(16-11)22-7-10(13)14/h6,10H,4-5,7,15H2,1-3H3.
What are the key properties of 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine?
6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine has a molecular weight of 319.31 g/mol, XLogP of 1.21, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoroethoxy)-2-N-[2-(dimethylamino)ethyl]-2-N-methyl-5-nitropyridine-2,3-diamine is sourced from PubChem (CID 130205878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).