C22H30N6O9P2 — CID 130205924
[[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-pyrrolidin-1-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130205924) has the molecular formula C22H30N6O9P2 and a molecular weight of 584.46 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-pyrrolidin-1-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-pyrrolidin-1-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130205924 |
| Molecular Formula | C22H30N6O9P2 |
| Molecular Weight | 584.46 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-pyrrolidin-1-ylpurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(N4CCCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H30N6O9P2/c29-17-15(11-36-39(34,35)13-38(31,32)33)37-21(18(17)30)28-12-24-16-19(23-10-14-6-2-1-3-7-14)25-22(26-20(16)28)27-8-4-5-9-27/h1-3,6-7,12,15,17-18,21,29-30H,4-5,8-11,13H2,(H,34,35)(H,23,25,26)(H2,31,32,33)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | KUXIRIUARNERMJ-QTQZEZTPSA-N |
| XLogP | 1.00 |
| TPSA | 212.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|