C19H23ClFN5O9P2 — CID 130205980
[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130205980) has the molecular formula C19H23ClFN5O9P2 and a molecular weight of 581.82 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130205980 |
| Molecular Formula | C19H23ClFN5O9P2 |
| Molecular Weight | 581.82 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluorophenyl)ethyl]amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1cnn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1F |
| InChI | InChI=1S/C19H23ClFN5O9P2/c1-9(10-4-2-3-5-12(10)21)23-16-11-6-22-26(17(11)25-19(20)24-16)18-15(28)14(27)13(35-18)7-34-37(32,33)8-36(29,30)31/h2-6,9,13-15,18,27-28H,7-8H2,1H3,(H,32,33)(H,23,24,25)(H2,29,30,31)/t9-,13+,14+,15+,18+/m0/s1 |
| InChIKey | RWXCJIIJAKSRDS-ACFNIHOCSA-N |
| XLogP | 1.75 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.82 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|