C12H18F2N4O3 — CID 130206033
1-[6-(2,2-difluoroethoxy)-5-nitro-2-pyridinyl]-N,N',N'-trimethylethane-1,2-diamine (PubChem CID 130206033) has the molecular formula C12H18F2N4O3 and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-[6-(2,2-difluoroethoxy)-5-nitro-2-pyridinyl]-N,N',N'-trimethylethane-1,2-diamine.
| Compound Name | 1-[6-(2,2-difluoroethoxy)-5-nitro-2-pyridinyl]-N,N',N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 130206033 |
| Molecular Formula | C12H18F2N4O3 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-[6-(2,2-difluoroethoxy)-5-nitro-2-pyridinyl]-N,N',N'-trimethylethane-1,2-diamine |
| SMILES | CNC(CN(C)C)c1ccc([N+](=O)[O-])c(OCC(F)F)n1 |
| InChI | InChI=1S/C12H18F2N4O3/c1-15-9(6-17(2)3)8-4-5-10(18(19)20)12(16-8)21-7-11(13)14/h4-5,9,11,15H,6-7H2,1-3H3 |
| InChIKey | DBTVPKPQUCAWFD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|