C98H86O8P2 — CID 130206434
ethyl 3,3-bis[4-bis(2,6-diphenylphenoxy)phosphanyloxy-3-tert-butylphenyl]butanoate (PubChem CID 130206434) has the molecular formula C98H86O8P2 and a molecular weight of 1453.71 g/mol. Its IUPAC name is ethyl 3,3-bis[4-bis(2,6-diphenylphenoxy)phosphanyloxy-3-tert-butylphenyl]butanoate.
| Compound Name | ethyl 3,3-bis[4-bis(2,6-diphenylphenoxy)phosphanyloxy-3-tert-butylphenyl]butanoate |
|---|---|
| PubChem CID | 130206434 |
| Molecular Formula | C98H86O8P2 |
| Molecular Weight | 1453.71 g/mol |
| Exact Mass | 1452.58 |
| IUPAC Name | ethyl 3,3-bis[4-bis(2,6-diphenylphenoxy)phosphanyloxy-3-tert-butylphenyl]butanoate |
| SMILES | CCOC(=O)CC(C)(c1ccc(OP(Oc2c(-c3ccccc3)cccc2-c2ccccc2)Oc2c(-c3ccccc3)cccc2-c2ccccc2)c(C(C)(C)C)c1)c1ccc(OP(Oc2c(-c3ccccc3)cccc2-c2ccccc2)Oc2c(-c3ccccc3)cccc2-c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C98H86O8P2/c1-9-100-91(99)68-98(8,77-62-64-89(87(66-77)96(2,3)4)101-107(103-92-79(69-38-18-10-19-39-69)54-34-55-80(92)70-40-20-11-21-41-70)104-93-81(71-42-22-12-23-43-71)56-35-57-82(93)72-44-24-13-25-45-72)78-63-65-90(88(67-78)97(5,6)7)102-108(105-94-83(73-46-26-14-27-47-73)58-36-59-84(94)74-48-28-15-29-49-74)106-95-85(75-50-30-16-31-51-75)60-37-61-86(95)76-52-32-17-33-53-76/h10-67H,9,68H2,1-8H3 |
| InChIKey | ZJYSDDUJZZLEHX-UHFFFAOYSA-N |
| XLogP | 27.40 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 108 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1453.71 |
| LogP ≤ 5 | 27.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|