C20H24O4 — CID 130206762
8,8,11,11-tetramethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-4,5,14,15-tetrol (PubChem CID 130206762) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 8,8,11,11-tetramethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-4,5,14,15-tetrol.
| Compound Name | 8,8,11,11-tetramethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-4,5,14,15-tetrol |
|---|---|
| PubChem CID | 130206762 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 8,8,11,11-tetramethyltricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-4,5,14,15-tetrol |
| SMILES | CC1(C)CCC(C)(C)c2cc(O)c(O)cc2-c2cc(O)c(O)cc21 |
| InChI | InChI=1S/C20H24O4/c1-19(2)5-6-20(3,4)14-10-18(24)16(22)8-12(14)11-7-15(21)17(23)9-13(11)19/h7-10,21-24H,5-6H2,1-4H3 |
| InChIKey | ZBZKILLMKDIPFG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|