About 4-butyl-1,2,3-trimethylimidazolidine
4-butyl-1,2,3-trimethylimidazolidine (PubChem CID 130206815) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 4-butyl-1,2,3-trimethylimidazolidine.
Molecular Properties
| Compound Name | 4-butyl-1,2,3-trimethylimidazolidine |
| PubChem CID | 130206815 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 4-butyl-1,2,3-trimethylimidazolidine |
| SMILES | CCCCC1CN(C)C(C)N1C |
| InChI | InChI=1S/C10H22N2/c1-5-6-7-10-8-11(3)9(2)12(10)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | HIMVKZDEHAXSCI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butyl-1,2,3-trimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,2,3-trimethylimidazolidine?
The IUPAC name of 4-butyl-1,2,3-trimethylimidazolidine (CID 130206815) is 4-butyl-1,2,3-trimethylimidazolidine.
What is the SMILES notation for 4-butyl-1,2,3-trimethylimidazolidine?
The canonical SMILES for 4-butyl-1,2,3-trimethylimidazolidine is CCCCC1CN(C)C(C)N1C.
What is the InChIKey of 4-butyl-1,2,3-trimethylimidazolidine?
The InChIKey is HIMVKZDEHAXSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-5-6-7-10-8-11(3)9(2)12(10)4/h9-10H,5-8H2,1-4H3.
What are the key properties of 4-butyl-1,2,3-trimethylimidazolidine?
4-butyl-1,2,3-trimethylimidazolidine has a molecular weight of 170.30 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,2,3-trimethylimidazolidine is sourced from PubChem (CID 130206815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).