C29H48N4O4 — CID 130207187
1-[6,9,13-tris(2-oxopyrrolidin-1-yl)tridecyl]pyrrolidin-2-one (PubChem CID 130207187) has the molecular formula C29H48N4O4 and a molecular weight of 516.73 g/mol. Its IUPAC name is 1-[6,9,13-tris(2-oxopyrrolidin-1-yl)tridecyl]pyrrolidin-2-one.
| Compound Name | 1-[6,9,13-tris(2-oxopyrrolidin-1-yl)tridecyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 130207187 |
| Molecular Formula | C29H48N4O4 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | 1-[6,9,13-tris(2-oxopyrrolidin-1-yl)tridecyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCCCC(CCC(CCCCN1CCCC1=O)N1CCCC1=O)N1CCCC1=O |
| InChI | InChI=1S/C29H48N4O4/c34-26-12-6-20-30(26)18-4-1-2-10-24(32-22-8-14-28(32)36)16-17-25(33-23-9-15-29(33)37)11-3-5-19-31-21-7-13-27(31)35/h24-25H,1-23H2 |
| InChIKey | WNSYOIHWIMMCHP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|