C11H7N3O4 — CID 130207216
2-amino-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 130207216) has the molecular formula C11H7N3O4 and a molecular weight of 245.19 g/mol. Its IUPAC name is 2-amino-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-amino-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 130207216 |
| Molecular Formula | C11H7N3O4 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-amino-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cn1c(=O)c2cc3c(=O)n(N)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C11H7N3O4/c1-13-8(15)4-2-6-7(3-5(4)9(13)16)11(18)14(12)10(6)17/h2-3H,12H2,1H3 |
| InChIKey | FGGAMRLLBBTSKG-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |