About 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine
6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 130207251) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 130207251 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCCC(CC)c1ccc2cc[nH]c2n1 |
| InChI | InChI=1S/C13H18N2/c1-3-5-10(4-2)12-7-6-11-8-9-14-13(11)15-12/h6-10H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | FONQAALFXHCDKL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine (CID 130207251) is 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine is CCCC(CC)c1ccc2cc[nH]c2n1.
What is the InChIKey of 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is FONQAALFXHCDKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-3-5-10(4-2)12-7-6-11-8-9-14-13(11)15-12/h6-10H,3-5H2,1-2H3,(H,14,15).
What are the key properties of 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine?
6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 202.30 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hexan-3-yl-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 130207251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).