C23H22N6O4 — CID 130207265
methyl 4-[5-[3-amino-6-[4-[dimethylamino(hydroxy)methyl]phenyl]pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]benzoate (PubChem CID 130207265) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is methyl 4-[5-[3-amino-6-[4-[dimethylamino(hydroxy)methyl]phenyl]pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-[3-amino-6-[4-[dimethylamino(hydroxy)methyl]phenyl]pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 130207265 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | methyl 4-[5-[3-amino-6-[4-[dimethylamino(hydroxy)methyl]phenyl]pyrazin-2-yl]-1,3,4-oxadiazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nnc(-c3nc(-c4ccc(C(O)N(C)C)cc4)cnc3N)o2)cc1 |
| InChI | InChI=1S/C23H22N6O4/c1-29(2)22(30)15-8-4-13(5-9-15)17-12-25-19(24)18(26-17)21-28-27-20(33-21)14-6-10-16(11-7-14)23(31)32-3/h4-12,22,30H,1-3H3,(H2,24,25) |
| InChIKey | SETWMGYGTBJPNX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|