About (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole
(4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole (PubChem CID 130207287) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole.
Molecular Properties
| Compound Name | (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole |
| PubChem CID | 130207287 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole |
| SMILES | C=C/C=c1/nc(C(C)C)[nH]/c1=C/C=C |
| InChI | InChI=1S/C12H16N2/c1-5-7-10-11(8-6-2)14-12(13-10)9(3)4/h5-9H,1-2H2,3-4H3,(H,13,14)/b10-7+,11-8+ |
| InChIKey | WGPIGJDUYLDSSF-AMMQDNIMSA-N |
| XLogP | 1.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole?
The IUPAC name of (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole (CID 130207287) is (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole.
What is the SMILES notation for (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole?
The canonical SMILES for (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole is C=C/C=c1/nc(C(C)C)[nH]/c1=C/C=C.
What is the InChIKey of (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole?
The InChIKey is WGPIGJDUYLDSSF-AMMQDNIMSA-N. The full InChI is InChI=1S/C12H16N2/c1-5-7-10-11(8-6-2)14-12(13-10)9(3)4/h5-9H,1-2H2,3-4H3,(H,13,14)/b10-7+,11-8+.
What are the key properties of (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole?
(4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole has a molecular weight of 188.27 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-2-propan-2-yl-4,5-bis(prop-2-enylidene)-1H-imidazole is sourced from PubChem (CID 130207287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).