C20H40N2O2 — CID 130207479
N-[2-[methoxymethyl-(4-methylcyclohexyl)amino]ethoxymethyl]-N,4-dimethylcyclohexan-1-amine (PubChem CID 130207479) has the molecular formula C20H40N2O2 and a molecular weight of 340.55 g/mol. Its IUPAC name is N-[2-[methoxymethyl-(4-methylcyclohexyl)amino]ethoxymethyl]-N,4-dimethylcyclohexan-1-amine.
| Compound Name | N-[2-[methoxymethyl-(4-methylcyclohexyl)amino]ethoxymethyl]-N,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 130207479 |
| Molecular Formula | C20H40N2O2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | N-[2-[methoxymethyl-(4-methylcyclohexyl)amino]ethoxymethyl]-N,4-dimethylcyclohexan-1-amine |
| SMILES | COCN(CCOCN(C)C1CCC(C)CC1)C1CCC(C)CC1 |
| InChI | InChI=1S/C20H40N2O2/c1-17-5-9-19(10-6-17)21(3)15-24-14-13-22(16-23-4)20-11-7-18(2)8-12-20/h17-20H,5-16H2,1-4H3 |
| InChIKey | FUTLJZLBUAJXHE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|