About N-iodo-5-methyl-1,3-thiazole-2-carboxamide
N-iodo-5-methyl-1,3-thiazole-2-carboxamide (PubChem CID 130207524) has the molecular formula C5H5IN2OS
and a molecular weight of 268.08 g/mol. Its IUPAC name is N-iodo-5-methyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-iodo-5-methyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 130207524 |
| Molecular Formula | C5H5IN2OS |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 267.92 |
| IUPAC Name | N-iodo-5-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NI)s1 |
| InChI | InChI=1S/C5H5IN2OS/c1-3-2-7-5(10-3)4(9)8-6/h2H,1H3,(H,8,9) |
| InChIKey | XFKPHBGSCAUELM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-5-methyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-5-methyl-1,3-thiazole-2-carboxamide?
The IUPAC name of N-iodo-5-methyl-1,3-thiazole-2-carboxamide (CID 130207524) is N-iodo-5-methyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-iodo-5-methyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-iodo-5-methyl-1,3-thiazole-2-carboxamide is Cc1cnc(C(=O)NI)s1.
What is the InChIKey of N-iodo-5-methyl-1,3-thiazole-2-carboxamide?
The InChIKey is XFKPHBGSCAUELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5IN2OS/c1-3-2-7-5(10-3)4(9)8-6/h2H,1H3,(H,8,9).
What are the key properties of N-iodo-5-methyl-1,3-thiazole-2-carboxamide?
N-iodo-5-methyl-1,3-thiazole-2-carboxamide has a molecular weight of 268.08 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-5-methyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 130207524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).