C31H46O7S — CID 130207995
[(1R,2R,4R,5S,6R,7R)-4-ethenyl-5-hydroxy-1,4,6,10,11-pentamethyl-7-(3-oxobutyl)-2-bicyclo[5.3.1]undecanyl] 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 130207995) has the molecular formula C31H46O7S and a molecular weight of 562.77 g/mol. Its IUPAC name is [(1R,2R,4R,5S,6R,7R)-4-ethenyl-5-hydroxy-1,4,6,10,11-pentamethyl-7-(3-oxobutyl)-2-bicyclo[5.3.1]undecanyl] 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | [(1R,2R,4R,5S,6R,7R)-4-ethenyl-5-hydroxy-1,4,6,10,11-pentamethyl-7-(3-oxobutyl)-2-bicyclo[5.3.1]undecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 130207995 |
| Molecular Formula | C31H46O7S |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | [(1R,2R,4R,5S,6R,7R)-4-ethenyl-5-hydroxy-1,4,6,10,11-pentamethyl-7-(3-oxobutyl)-2-bicyclo[5.3.1]undecanyl] 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | C=C[C@@]1(C)C[C@@H](OC(=O)COS(=O)(=O)c2ccc(C)cc2)[C@]2(C)C(C)CC[C@@](CCC(C)=O)(C2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H46O7S/c1-9-29(7)18-26(38-27(33)19-37-39(35,36)25-12-10-20(2)11-13-25)30(8)21(3)14-16-31(24(30)6,17-15-22(4)32)23(5)28(29)34/h9-13,21,23-24,26,28,34H,1,14-19H2,2-8H3/t21?,23-,24?,26+,28-,29-,30+,31-/m0/s1 |
| InChIKey | UUEOAYNUBQXQTE-XHFXULORSA-N |
| XLogP | 5.63 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|