C56H102O12 — CID 130208588
hexakis(2-methylbutan-2-yl) 1,1,3,5,7,9,11-heptamethyltridecane-1,3,5,7,9,11-hexacarboxylate (PubChem CID 130208588) has the molecular formula C56H102O12 and a molecular weight of 967.42 g/mol. Its IUPAC name is hexakis(2-methylbutan-2-yl) 1,1,3,5,7,9,11-heptamethyltridecane-1,3,5,7,9,11-hexacarboxylate.
| Compound Name | hexakis(2-methylbutan-2-yl) 1,1,3,5,7,9,11-heptamethyltridecane-1,3,5,7,9,11-hexacarboxylate |
|---|---|
| PubChem CID | 130208588 |
| Molecular Formula | C56H102O12 |
| Molecular Weight | 967.42 g/mol |
| Exact Mass | 966.74 |
| IUPAC Name | hexakis(2-methylbutan-2-yl) 1,1,3,5,7,9,11-heptamethyltridecane-1,3,5,7,9,11-hexacarboxylate |
| SMILES | CCC(C)(C)OC(=O)C(C)(C)CC(C)(CC(C)(CC(C)(CC(C)(CC(C)(CC)C(=O)OC(C)(C)CC)C(=O)OC(C)(C)CC)C(=O)OC(C)(C)CC)C(=O)OC(C)(C)CC)C(=O)OC(C)(C)CC |
| InChI | InChI=1S/C56H102O12/c1-27-46(10,11)63-39(57)45(8,9)34-53(23,41(59)65-48(14,15)29-3)36-55(25,43(61)67-50(18,19)31-5)38-56(26,44(62)68-51(20,21)32-6)37-54(24,42(60)66-49(16,17)30-4)35-52(22,33-7)40(58)64-47(12,13)28-2/h27-38H2,1-26H3 |
| InChIKey | QPAWZVTXAAYVDR-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.42 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|