C16H29N3 — CID 130208868
(3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine (PubChem CID 130208868) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is (3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine.
| Compound Name | (3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
|---|---|
| PubChem CID | 130208868 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | (3S,6R)-1,4-ditert-butyl-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
| SMILES | C[C@@H]1N=C(C(C)(C)C)N2C[C@H](N)CC2=C1C(C)(C)C |
| InChI | InChI=1S/C16H29N3/c1-10-13(15(2,3)4)12-8-11(17)9-19(12)14(18-10)16(5,6)7/h10-11H,8-9,17H2,1-7H3/t10-,11+/m0/s1 |
| InChIKey | HHWWDTQSJIFNGC-WDEREUQCSA-N |
| XLogP | 3.17 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |