C25H39N3O2 — CID 130209000
[(3R,8S)-6,9-ditert-butyl-2-[(4-methoxyphenyl)methyl]-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-3-yl]methanol (PubChem CID 130209000) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is [(3R,8S)-6,9-ditert-butyl-2-[(4-methoxyphenyl)methyl]-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-3-yl]methanol.
| Compound Name | [(3R,8S)-6,9-ditert-butyl-2-[(4-methoxyphenyl)methyl]-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-3-yl]methanol |
|---|---|
| PubChem CID | 130209000 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | [(3R,8S)-6,9-ditert-butyl-2-[(4-methoxyphenyl)methyl]-8-methyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidin-3-yl]methanol |
| SMILES | COc1ccc(CN2CC3=C(C(C)(C)C)[C@H](C)N=C(C(C)(C)C)N3C[C@@H]2CO)cc1 |
| InChI | InChI=1S/C25H39N3O2/c1-17-22(24(2,3)4)21-15-27(13-18-9-11-20(30-8)12-10-18)19(16-29)14-28(21)23(26-17)25(5,6)7/h9-12,17,19,29H,13-16H2,1-8H3/t17-,19+/m0/s1 |
| InChIKey | VMKGCMWENJCXPQ-PKOBYXMFSA-N |
| XLogP | 4.32 |
| TPSA | 48.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |