C24H25BrFN3O6S — CID 130209057
diethyl 2-[[(4R)-4-(2-bromo-4-fluorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]propanedioate (PubChem CID 130209057) has the molecular formula C24H25BrFN3O6S and a molecular weight of 582.45 g/mol. Its IUPAC name is diethyl 2-[[(4R)-4-(2-bromo-4-fluorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(4R)-4-(2-bromo-4-fluorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 130209057 |
| Molecular Formula | C24H25BrFN3O6S |
| Molecular Weight | 582.45 g/mol |
| Exact Mass | 581.06 |
| IUPAC Name | diethyl 2-[[(4R)-4-(2-bromo-4-fluorophenyl)-5-ethoxycarbonyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidin-6-yl]methyl]propanedioate |
| SMILES | CCOC(=O)C1=C(CC(C(=O)OCC)C(=O)OCC)NC(c2nccs2)=N[C@H]1c1ccc(F)cc1Br |
| InChI | InChI=1S/C24H25BrFN3O6S/c1-4-33-22(30)15(23(31)34-5-2)12-17-18(24(32)35-6-3)19(14-8-7-13(26)11-16(14)25)29-20(28-17)21-27-9-10-36-21/h7-11,15,19H,4-6,12H2,1-3H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | PKNFMNDACQNVRM-IBGZPJMESA-N |
| XLogP | 4.09 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|