C33H38FN5O3 — CID 130209206
1-[(2R,5S)-4-[2-[3-(dimethylamino)propoxy]-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-6-methylquinazolin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 130209206) has the molecular formula C33H38FN5O3 and a molecular weight of 571.70 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[2-[3-(dimethylamino)propoxy]-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-6-methylquinazolin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-4-[2-[3-(dimethylamino)propoxy]-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-6-methylquinazolin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130209206 |
| Molecular Formula | C33H38FN5O3 |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 1-[(2R,5S)-4-[2-[3-(dimethylamino)propoxy]-8-fluoro-7-(3-hydroxynaphthalen-1-yl)-6-methylquinazolin-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2nc(OCCCN(C)C)nc3c(F)c(-c4cc(O)cc5ccccc45)c(C)cc23)C[C@H]1C |
| InChI | InChI=1S/C33H38FN5O3/c1-7-28(41)38-18-22(4)39(19-21(38)3)32-27-15-20(2)29(26-17-24(40)16-23-11-8-9-12-25(23)26)30(34)31(27)35-33(36-32)42-14-10-13-37(5)6/h7-9,11-12,15-17,21-22,40H,1,10,13-14,18-19H2,2-6H3/t21-,22+/m1/s1 |
| InChIKey | KSSDBKTVUDTVQY-YADHBBJMSA-N |
| XLogP | 5.55 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|