About 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline
6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline (PubChem CID 130209544) has the molecular formula C12H9FN2S
and a molecular weight of 232.28 g/mol. Its IUPAC name is 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline.
Molecular Properties
| Compound Name | 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline |
| PubChem CID | 130209544 |
| Molecular Formula | C12H9FN2S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline |
| SMILES | Cc1cc(F)c(C)c2nc3cscc3nc12 |
| InChI | InChI=1S/C12H9FN2S/c1-6-3-8(13)7(2)12-11(6)14-9-4-16-5-10(9)15-12/h3-5H,1-2H3 |
| InChIKey | WLKUOZBBBADIDU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline?
The IUPAC name of 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline (CID 130209544) is 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline.
What is the SMILES notation for 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline?
The canonical SMILES for 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline is Cc1cc(F)c(C)c2nc3cscc3nc12.
What is the InChIKey of 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline?
The InChIKey is WLKUOZBBBADIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2S/c1-6-3-8(13)7(2)12-11(6)14-9-4-16-5-10(9)15-12/h3-5H,1-2H3.
What are the key properties of 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline?
6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline has a molecular weight of 232.28 g/mol, XLogP of 3.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-5,8-dimethylthieno[3,4-b]quinoxaline is sourced from PubChem (CID 130209544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).