About bis(but-3-ynyl) 2-ethylpropanedioate
bis(but-3-ynyl) 2-ethylpropanedioate (PubChem CID 130209965) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is bis(but-3-ynyl) 2-ethylpropanedioate.
Molecular Properties
| Compound Name | bis(but-3-ynyl) 2-ethylpropanedioate |
| PubChem CID | 130209965 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | bis(but-3-ynyl) 2-ethylpropanedioate |
| SMILES | C#CCCOC(=O)C(CC)C(=O)OCCC#C |
| InChI | InChI=1S/C13H16O4/c1-4-7-9-16-12(14)11(6-3)13(15)17-10-8-5-2/h1-2,11H,6-10H2,3H3 |
| InChIKey | IEGKNIRQBJIXFI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(but-3-ynyl) 2-ethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(but-3-ynyl) 2-ethylpropanedioate?
The IUPAC name of bis(but-3-ynyl) 2-ethylpropanedioate (CID 130209965) is bis(but-3-ynyl) 2-ethylpropanedioate.
What is the SMILES notation for bis(but-3-ynyl) 2-ethylpropanedioate?
The canonical SMILES for bis(but-3-ynyl) 2-ethylpropanedioate is C#CCCOC(=O)C(CC)C(=O)OCCC#C.
What is the InChIKey of bis(but-3-ynyl) 2-ethylpropanedioate?
The InChIKey is IEGKNIRQBJIXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-4-7-9-16-12(14)11(6-3)13(15)17-10-8-5-2/h1-2,11H,6-10H2,3H3.
What are the key properties of bis(but-3-ynyl) 2-ethylpropanedioate?
bis(but-3-ynyl) 2-ethylpropanedioate has a molecular weight of 236.27 g/mol, XLogP of 1.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(but-3-ynyl) 2-ethylpropanedioate is sourced from PubChem (CID 130209965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).