C46H28N6O — CID 130210612
13-[4-(4,6-dipyridin-3-ylpyrimidin-2-yl)phenyl]-15-(3-phenylphenyl)-17-oxa-12,14-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene (PubChem CID 130210612) has the molecular formula C46H28N6O and a molecular weight of 680.77 g/mol. Its IUPAC name is 13-[4-(4,6-dipyridin-3-ylpyrimidin-2-yl)phenyl]-15-(3-phenylphenyl)-17-oxa-12,14-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene.
| Compound Name | 13-[4-(4,6-dipyridin-3-ylpyrimidin-2-yl)phenyl]-15-(3-phenylphenyl)-17-oxa-12,14-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 130210612 |
| Molecular Formula | C46H28N6O |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.23 |
| IUPAC Name | 13-[4-(4,6-dipyridin-3-ylpyrimidin-2-yl)phenyl]-15-(3-phenylphenyl)-17-oxa-12,14-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc(-c5nc(-c6cccnc6)cc(-c6cccnc6)n5)cc4)nc4c3oc3cc5ccccc5cc34)c2)cc1 |
| InChI | InChI=1S/C46H28N6O/c1-2-9-29(10-3-1)32-13-6-14-35(23-32)42-44-43(38-24-33-11-4-5-12-34(33)25-41(38)53-44)52-46(51-42)31-19-17-30(18-20-31)45-49-39(36-15-7-21-47-27-36)26-40(50-45)37-16-8-22-48-28-37/h1-28H |
| InChIKey | OGMUEUUIOYMZRP-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |