C40H26N2S — CID 130210666
2-[4-(3,5-diphenylphenyl)phenyl]-4-phenyl-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 130210666) has the molecular formula C40H26N2S and a molecular weight of 566.73 g/mol. Its IUPAC name is 2-[4-(3,5-diphenylphenyl)phenyl]-4-phenyl-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 2-[4-(3,5-diphenylphenyl)phenyl]-4-phenyl-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 130210666 |
| Molecular Formula | C40H26N2S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[4-(3,5-diphenylphenyl)phenyl]-4-phenyl-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(-c4nc(-c5ccccc5)c5c(n4)sc4ccccc45)cc3)c2)cc1 |
| InChI | InChI=1S/C40H26N2S/c1-4-12-27(13-5-1)32-24-33(28-14-6-2-7-15-28)26-34(25-32)29-20-22-31(23-21-29)39-41-38(30-16-8-3-9-17-30)37-35-18-10-11-19-36(35)43-40(37)42-39/h1-26H |
| InChIKey | NTWRPUNFHCDCRP-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |