About 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane
2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane (PubChem CID 130210947) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane.
Molecular Properties
| Compound Name | 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane |
| PubChem CID | 130210947 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane |
| SMILES | C1=CC(c2ccc(C3CO3)cc2)C=C1 |
| InChI | InChI=1S/C13H12O/c1-2-4-10(3-1)11-5-7-12(8-6-11)13-9-14-13/h1-8,10,13H,9H2 |
| InChIKey | XUBKRFLDXNADGP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane?
The IUPAC name of 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane (CID 130210947) is 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane.
What is the SMILES notation for 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane?
The canonical SMILES for 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane is C1=CC(c2ccc(C3CO3)cc2)C=C1.
What is the InChIKey of 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane?
The InChIKey is XUBKRFLDXNADGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-2-4-10(3-1)11-5-7-12(8-6-11)13-9-14-13/h1-8,10,13H,9H2.
What are the key properties of 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane?
2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane has a molecular weight of 184.24 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclopenta-2,4-dien-1-ylphenyl)oxirane is sourced from PubChem (CID 130210947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).