C12H19F5O2 — CID 130211313
1,1,1,4-tetrafluoro-3-(2-fluoropropan-2-yl)-2-(2-methoxyethoxy)-4-methylpent-2-ene (PubChem CID 130211313) has the molecular formula C12H19F5O2 and a molecular weight of 290.27 g/mol. Its IUPAC name is 1,1,1,4-tetrafluoro-3-(2-fluoropropan-2-yl)-2-(2-methoxyethoxy)-4-methylpent-2-ene.
| Compound Name | 1,1,1,4-tetrafluoro-3-(2-fluoropropan-2-yl)-2-(2-methoxyethoxy)-4-methylpent-2-ene |
|---|---|
| PubChem CID | 130211313 |
| Molecular Formula | C12H19F5O2 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1,1,1,4-tetrafluoro-3-(2-fluoropropan-2-yl)-2-(2-methoxyethoxy)-4-methylpent-2-ene |
| SMILES | COCCOC(=C(C(C)(C)F)C(C)(C)F)C(F)(F)F |
| InChI | InChI=1S/C12H19F5O2/c1-10(2,13)8(11(3,4)14)9(12(15,16)17)19-7-6-18-5/h6-7H2,1-5H3 |
| InChIKey | PMPFKTBXEZRQBV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|