About prop-2-enyl N,N-dipropylcarbamodithioate
prop-2-enyl N,N-dipropylcarbamodithioate (PubChem CID 13021142) has the molecular formula C10H19NS2
and a molecular weight of 217.40 g/mol. Its IUPAC name is prop-2-enyl N,N-dipropylcarbamodithioate.
Molecular Properties
| Compound Name | prop-2-enyl N,N-dipropylcarbamodithioate |
| PubChem CID | 13021142 |
| Molecular Formula | C10H19NS2 |
| Molecular Weight | 217.40 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | prop-2-enyl N,N-dipropylcarbamodithioate |
| SMILES | C=CCSC(=S)N(CCC)CCC |
| InChI | InChI=1S/C10H19NS2/c1-4-7-11(8-5-2)10(12)13-9-6-3/h6H,3-5,7-9H2,1-2H3 |
| InChIKey | YMBFLCPZECCTSC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N,N-dipropylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N,N-dipropylcarbamodithioate?
The IUPAC name of prop-2-enyl N,N-dipropylcarbamodithioate (CID 13021142) is prop-2-enyl N,N-dipropylcarbamodithioate.
What is the SMILES notation for prop-2-enyl N,N-dipropylcarbamodithioate?
The canonical SMILES for prop-2-enyl N,N-dipropylcarbamodithioate is C=CCSC(=S)N(CCC)CCC.
What is the InChIKey of prop-2-enyl N,N-dipropylcarbamodithioate?
The InChIKey is YMBFLCPZECCTSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS2/c1-4-7-11(8-5-2)10(12)13-9-6-3/h6H,3-5,7-9H2,1-2H3.
What are the key properties of prop-2-enyl N,N-dipropylcarbamodithioate?
prop-2-enyl N,N-dipropylcarbamodithioate has a molecular weight of 217.40 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N,N-dipropylcarbamodithioate is sourced from PubChem (CID 13021142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).