C24H31FN4O — CID 130214391
2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1-[1-[(4-fluorophenyl)methyl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]ethanone (PubChem CID 130214391) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1-[1-[(4-fluorophenyl)methyl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]ethanone.
| Compound Name | 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1-[1-[(4-fluorophenyl)methyl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 130214391 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-1-[1-[(4-fluorophenyl)methyl]-3-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]ethanone |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c2c1CCN(C(=O)CC1CCN3CCCC3C1)C2 |
| InChI | InChI=1S/C24H31FN4O/c1-17-22-9-12-28(24(30)14-19-8-11-27-10-2-3-21(27)13-19)16-23(22)29(26-17)15-18-4-6-20(25)7-5-18/h4-7,19,21H,2-3,8-16H2,1H3 |
| InChIKey | XVFANVYSFROMID-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |