C25H30N8O4S — CID 130214816
1-[3-[[(2R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-(1,3-thiazol-4-yl)phenyl]urea (PubChem CID 130214816) has the molecular formula C25H30N8O4S and a molecular weight of 538.63 g/mol. Its IUPAC name is 1-[3-[[(2R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-(1,3-thiazol-4-yl)phenyl]urea.
| Compound Name | 1-[3-[[(2R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-(1,3-thiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 130214816 |
| Molecular Formula | C25H30N8O4S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 1-[3-[[(2R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-[4-(1,3-thiazol-4-yl)phenyl]urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(-c2cscn2)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ccnc32)C(O)C1O |
| InChI | InChI=1S/C25H30N8O4S/c1-32(10-2-8-28-25(36)31-16-5-3-15(4-6-16)18-12-38-14-30-18)11-19-21(34)22(35)24(37-19)33-13-29-20-17(26)7-9-27-23(20)33/h3-7,9,12-14,19,21-22,24,34-35H,2,8,10-11H2,1H3,(H2,26,27)(H2,28,31,36)/t19-,21?,22?,24-/m1/s1 |
| InChIKey | UGXZGJZRQUHPQF-VCSHYFGYSA-N |
| XLogP | 1.90 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|