About 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene
2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene (PubChem CID 130215312) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene |
| PubChem CID | 130215312 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene |
| SMILES | CCOCC(COCC)CC1=CC(C)C(C)C=C1 |
| InChI | InChI=1S/C16H28O2/c1-5-17-11-16(12-18-6-2)10-15-8-7-13(3)14(4)9-15/h7-9,13-14,16H,5-6,10-12H2,1-4H3 |
| InChIKey | JYCTUTATMIYSOA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene?
The IUPAC name of 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene (CID 130215312) is 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene is CCOCC(COCC)CC1=CC(C)C(C)C=C1.
What is the InChIKey of 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene?
The InChIKey is JYCTUTATMIYSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-5-17-11-16(12-18-6-2)10-15-8-7-13(3)14(4)9-15/h7-9,13-14,16H,5-6,10-12H2,1-4H3.
What are the key properties of 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene?
2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene has a molecular weight of 252.40 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-ethoxy-2-(ethoxymethyl)propyl]-5,6-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 130215312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).