C29H31N3O5S2 — CID 130215420
(1S)-3-[4-[2-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylphenyl]methoxy]-5-methylphenyl]-1,3-thiazol-2-yl]-3-azatricyclo[3.1.0.02,6]hexane-1-carboxylic acid (PubChem CID 130215420) has the molecular formula C29H31N3O5S2 and a molecular weight of 565.72 g/mol. Its IUPAC name is (1S)-3-[4-[2-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylphenyl]methoxy]-5-methylphenyl]-1,3-thiazol-2-yl]-3-azatricyclo[3.1.0.02,6]hexane-1-carboxylic acid.
| Compound Name | (1S)-3-[4-[2-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylphenyl]methoxy]-5-methylphenyl]-1,3-thiazol-2-yl]-3-azatricyclo[3.1.0.02,6]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 130215420 |
| Molecular Formula | C29H31N3O5S2 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | (1S)-3-[4-[2-[[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methylphenyl]methoxy]-5-methylphenyl]-1,3-thiazol-2-yl]-3-azatricyclo[3.1.0.02,6]hexane-1-carboxylic acid |
| SMILES | Cc1ccc(OCc2ccc(CN3CCS(=O)(=O)CC3)cc2C)c(-c2csc(N3CC4C5C3[C@]45C(=O)O)n2)c1 |
| InChI | InChI=1S/C29H31N3O5S2/c1-17-3-6-24(37-15-20-5-4-19(12-18(20)2)13-31-7-9-39(35,36)10-8-31)21(11-17)23-16-38-28(30-23)32-14-22-25-26(32)29(22,25)27(33)34/h3-6,11-12,16,22,25-26H,7-10,13-15H2,1-2H3,(H,33,34)/t22?,25?,26?,29-/m0/s1 |
| InChIKey | PRIKLSCGCYQPQV-XGDQEGKISA-N |
| XLogP | 3.76 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |