C10H13F3N2O — CID 130215816
3-amino-5,5-dimethyl-2-(2,2,2-trifluoroethanimidoyl)cyclohex-2-en-1-one (PubChem CID 130215816) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 3-amino-5,5-dimethyl-2-(2,2,2-trifluoroethanimidoyl)cyclohex-2-en-1-one.
| Compound Name | 3-amino-5,5-dimethyl-2-(2,2,2-trifluoroethanimidoyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130215816 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-amino-5,5-dimethyl-2-(2,2,2-trifluoroethanimidoyl)cyclohex-2-en-1-one |
| SMILES | [H]/N=C(/C1=C(N)CC(C)(C)CC1=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O/c1-9(2)3-5(14)7(6(16)4-9)8(15)10(11,12)13/h15H,3-4,14H2,1-2H3/b15-8- |
| InChIKey | PDMFUOWHNKSWBN-NVNXTCNLSA-N |
| XLogP | 2.17 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|