C19H28N2O2 — CID 130216236
4-methyl-5-[[methyl-[3-[3-(methylideneamino)propoxy]but-1-en-2-yl]amino]methyl]cyclohepta-2,4,6-triene-1-carbaldehyde (PubChem CID 130216236) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-methyl-5-[[methyl-[3-[3-(methylideneamino)propoxy]but-1-en-2-yl]amino]methyl]cyclohepta-2,4,6-triene-1-carbaldehyde.
| Compound Name | 4-methyl-5-[[methyl-[3-[3-(methylideneamino)propoxy]but-1-en-2-yl]amino]methyl]cyclohepta-2,4,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 130216236 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 4-methyl-5-[[methyl-[3-[3-(methylideneamino)propoxy]but-1-en-2-yl]amino]methyl]cyclohepta-2,4,6-triene-1-carbaldehyde |
| SMILES | C=NCCCOC(C)C(=C)N(C)CC1=C(C)C=CC(C=O)C=C1 |
| InChI | InChI=1S/C19H28N2O2/c1-15-7-8-18(14-22)9-10-19(15)13-21(5)16(2)17(3)23-12-6-11-20-4/h7-10,14,17-18H,2,4,6,11-13H2,1,3,5H3 |
| InChIKey | IGNQJWLWUZCRDB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|