About N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide
N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide (PubChem CID 130216255) has the molecular formula C26H41N3O3
and a molecular weight of 443.63 g/mol. Its IUPAC name is N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide.
Molecular Properties
| Compound Name | N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide |
| PubChem CID | 130216255 |
| Molecular Formula | C26H41N3O3 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide |
| SMILES | C=C(NCCN1CCC(CNC(=O)c2cc(OCC)cc(OCC)c2)CC1)C1CCCC1 |
| InChI | InChI=1S/C26H41N3O3/c1-4-31-24-16-23(17-25(18-24)32-5-2)26(30)28-19-21-10-13-29(14-11-21)15-12-27-20(3)22-8-6-7-9-22/h16-18,21-22,27H,3-15,19H2,1-2H3,(H,28,30) |
| InChIKey | VHWXDZYQCSQHLI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide?
The IUPAC name of N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide (CID 130216255) is N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide.
What is the SMILES notation for N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide?
The canonical SMILES for N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide is C=C(NCCN1CCC(CNC(=O)c2cc(OCC)cc(OCC)c2)CC1)C1CCCC1.
What is the InChIKey of N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide?
The InChIKey is VHWXDZYQCSQHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H41N3O3/c1-4-31-24-16-23(17-25(18-24)32-5-2)26(30)28-19-21-10-13-29(14-11-21)15-12-27-20(3)22-8-6-7-9-22/h16-18,21-22,27H,3-15,19H2,1-2H3,(H,28,30).
What are the key properties of N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide?
N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide has a molecular weight of 443.63 g/mol, XLogP of 4.22, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[2-(1-cyclopentylethenylamino)ethyl]piperidin-4-yl]methyl]-3,5-diethoxybenzamide is sourced from PubChem (CID 130216255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).