C21H32N2 — CID 130216362
(3E,7Z)-6-[1-(3,4-dimethylpenta-1,4-dien-2-yl)piperidin-4-yl]nona-3,7-dienenitrile (PubChem CID 130216362) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (3E,7Z)-6-[1-(3,4-dimethylpenta-1,4-dien-2-yl)piperidin-4-yl]nona-3,7-dienenitrile.
| Compound Name | (3E,7Z)-6-[1-(3,4-dimethylpenta-1,4-dien-2-yl)piperidin-4-yl]nona-3,7-dienenitrile |
|---|---|
| PubChem CID | 130216362 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (3E,7Z)-6-[1-(3,4-dimethylpenta-1,4-dien-2-yl)piperidin-4-yl]nona-3,7-dienenitrile |
| SMILES | C=C(C)C(C)C(=C)N1CCC(C(/C=C\C)C/C=C/CC#N)CC1 |
| InChI | InChI=1S/C21H32N2/c1-6-10-20(11-8-7-9-14-22)21-12-15-23(16-13-21)19(5)18(4)17(2)3/h6-8,10,18,20-21H,2,5,9,11-13,15-16H2,1,3-4H3/b8-7+,10-6- |
| InChIKey | HFPXZPKYUDXNHQ-BGDUUMEQSA-N |
| XLogP | 5.48 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|