C21H34FN3O2 — CID 130216418
(2E,4Z)-N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-6-fluoro-2,4-dimethylhepta-2,4,6-trienamide (PubChem CID 130216418) has the molecular formula C21H34FN3O2 and a molecular weight of 379.52 g/mol. Its IUPAC name is (2E,4Z)-N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-6-fluoro-2,4-dimethylhepta-2,4,6-trienamide.
| Compound Name | (2E,4Z)-N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-6-fluoro-2,4-dimethylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 130216418 |
| Molecular Formula | C21H34FN3O2 |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (2E,4Z)-N-[[1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl]methyl]-6-fluoro-2,4-dimethylhepta-2,4,6-trienamide |
| SMILES | C=C(F)/C=C(C)\C=C(/C)C(=O)NCC1CCN(CC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H34FN3O2/c1-15(12-17(3)22)11-16(2)20(27)23-13-18-7-9-25(10-8-18)14-19(26)24-21(4,5)6/h11-12,18H,3,7-10,13-14H2,1-2,4-6H3,(H,23,27)(H,24,26)/b15-12-,16-11+ |
| InChIKey | NKINBXCDZKRWIL-QKMJZAKKSA-N |
| XLogP | 3.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|