About 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine
4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine (PubChem CID 130216521) has the molecular formula C16H28FN
and a molecular weight of 253.40 g/mol. Its IUPAC name is 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine |
| PubChem CID | 130216521 |
| Molecular Formula | C16H28FN |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine |
| SMILES | CCC/C(C)=C\C/C=C(\C)C1(F)CCN(C)CC1 |
| InChI | InChI=1S/C16H28FN/c1-5-7-14(2)8-6-9-15(3)16(17)10-12-18(4)13-11-16/h8-9H,5-7,10-13H2,1-4H3/b14-8-,15-9+ |
| InChIKey | IGZINHXNVPWIRJ-DJJIWSAGSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine?
The IUPAC name of 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine (CID 130216521) is 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine.
What is the SMILES notation for 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine?
The canonical SMILES for 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine is CCC/C(C)=C\C/C=C(\C)C1(F)CCN(C)CC1.
What is the InChIKey of 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine?
The InChIKey is IGZINHXNVPWIRJ-DJJIWSAGSA-N. The full InChI is InChI=1S/C16H28FN/c1-5-7-14(2)8-6-9-15(3)16(17)10-12-18(4)13-11-16/h8-9H,5-7,10-13H2,1-4H3/b14-8-,15-9+.
What are the key properties of 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine?
4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine has a molecular weight of 253.40 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-methyl-4-[(2E,5Z)-6-methylnona-2,5-dien-2-yl]piperidine is sourced from PubChem (CID 130216521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).