C26H37F6NO2 — CID 130216525
N-[[4-(8-oxodecyl)cyclohexyl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 130216525) has the molecular formula C26H37F6NO2 and a molecular weight of 509.58 g/mol. Its IUPAC name is N-[[4-(8-oxodecyl)cyclohexyl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N-[[4-(8-oxodecyl)cyclohexyl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 130216525 |
| Molecular Formula | C26H37F6NO2 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | N-[[4-(8-oxodecyl)cyclohexyl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCC(=O)CCCCCCCC1CCC(CNC(=O)C2=CC(C(F)(F)F)=CC(C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C26H37F6NO2/c1-2-23(34)9-7-5-3-4-6-8-18-10-12-19(13-11-18)17-33-24(35)20-14-21(25(27,28)29)16-22(15-20)26(30,31)32/h14,16,18-19,22H,2-13,15,17H2,1H3,(H,33,35) |
| InChIKey | PRKHZJXXNWSOOV-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|