C17H30FN3 — CID 130216591
(Z)-2-buta-1,3-dien-2-yl-N-(1-fluoroethyl)-N'-(3-pyrrolidin-3-ylpropyl)but-1-ene-1,4-diamine (PubChem CID 130216591) has the molecular formula C17H30FN3 and a molecular weight of 295.45 g/mol. Its IUPAC name is (Z)-2-buta-1,3-dien-2-yl-N-(1-fluoroethyl)-N'-(3-pyrrolidin-3-ylpropyl)but-1-ene-1,4-diamine.
| Compound Name | (Z)-2-buta-1,3-dien-2-yl-N-(1-fluoroethyl)-N'-(3-pyrrolidin-3-ylpropyl)but-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 130216591 |
| Molecular Formula | C17H30FN3 |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | (Z)-2-buta-1,3-dien-2-yl-N-(1-fluoroethyl)-N'-(3-pyrrolidin-3-ylpropyl)but-1-ene-1,4-diamine |
| SMILES | C=CC(=C)/C(=C\NC(C)F)CCNCCCC1CCNC1 |
| InChI | InChI=1S/C17H30FN3/c1-4-14(2)17(13-21-15(3)18)8-11-19-9-5-6-16-7-10-20-12-16/h4,13,15-16,19-21H,1-2,5-12H2,3H3/b17-13- |
| InChIKey | PKTKCHXWHQDQRE-LGMDPLHJSA-N |
| XLogP | 2.89 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|