C12H19NO — CID 130216597
4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]morpholine (PubChem CID 130216597) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]morpholine.
| Compound Name | 4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]morpholine |
|---|---|
| PubChem CID | 130216597 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]morpholine |
| SMILES | C=C/C(C)=C\C=C(/C)N1CCOCC1 |
| InChI | InChI=1S/C12H19NO/c1-4-11(2)5-6-12(3)13-7-9-14-10-8-13/h4-6H,1,7-10H2,2-3H3/b11-5-,12-6+ |
| InChIKey | GJYGELPCCOCCRH-JTAXDKCCSA-N |
| XLogP | 2.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|