C19H29N3 — CID 130216638
7-N,5-dimethyl-7-N-(2-methylpent-3-ynyl)-4-N-pent-1-en-2-yl-2H-azepine-4,7-diamine (PubChem CID 130216638) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 7-N,5-dimethyl-7-N-(2-methylpent-3-ynyl)-4-N-pent-1-en-2-yl-2H-azepine-4,7-diamine.
| Compound Name | 7-N,5-dimethyl-7-N-(2-methylpent-3-ynyl)-4-N-pent-1-en-2-yl-2H-azepine-4,7-diamine |
|---|---|
| PubChem CID | 130216638 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 7-N,5-dimethyl-7-N-(2-methylpent-3-ynyl)-4-N-pent-1-en-2-yl-2H-azepine-4,7-diamine |
| SMILES | C=C(CCC)NC1=CCN=C(N(C)CC(C)C#CC)C=C1C |
| InChI | InChI=1S/C19H29N3/c1-7-9-15(3)14-22(6)19-13-16(4)18(11-12-20-19)21-17(5)10-8-2/h11,13,15,21H,5,8,10,12,14H2,1-4,6H3 |
| InChIKey | DIYRVXMYYXHKQK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|