C14H20FN — CID 130217155
(1R,2R)-1-fluoro-N-methyl-1-(6-methylcyclohexa-1,3-dien-1-yl)-N-prop-2-ynylpropan-2-amine (PubChem CID 130217155) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is (1R,2R)-1-fluoro-N-methyl-1-(6-methylcyclohexa-1,3-dien-1-yl)-N-prop-2-ynylpropan-2-amine.
| Compound Name | (1R,2R)-1-fluoro-N-methyl-1-(6-methylcyclohexa-1,3-dien-1-yl)-N-prop-2-ynylpropan-2-amine |
|---|---|
| PubChem CID | 130217155 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (1R,2R)-1-fluoro-N-methyl-1-(6-methylcyclohexa-1,3-dien-1-yl)-N-prop-2-ynylpropan-2-amine |
| SMILES | C#CCN(C)[C@H](C)[C@H](F)C1=CC=CCC1C |
| InChI | InChI=1S/C14H20FN/c1-5-10-16(4)12(3)14(15)13-9-7-6-8-11(13)2/h1,6-7,9,11-12,14H,8,10H2,2-4H3/t11?,12-,14+/m1/s1 |
| InChIKey | XAUKJCLGJNRKDB-AOUZGSJDSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|