C4H9N3O — CID 130217285
(4R)-2-amino-1,2,3,4-tetrahydropyrimidin-4-ol (PubChem CID 130217285) has the molecular formula C4H9N3O and a molecular weight of 115.14 g/mol. Its IUPAC name is (4R)-2-amino-1,2,3,4-tetrahydropyrimidin-4-ol.
| Compound Name | (4R)-2-amino-1,2,3,4-tetrahydropyrimidin-4-ol |
|---|---|
| PubChem CID | 130217285 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | (4R)-2-amino-1,2,3,4-tetrahydropyrimidin-4-ol |
| SMILES | NC1NC=C[C@@H](O)N1 |
| InChI | InChI=1S/C4H9N3O/c5-4-6-2-1-3(8)7-4/h1-4,6-8H,5H2/t3-,4?/m1/s1 |
| InChIKey | SLFGQGYDNIUKCZ-SYPWQXSBSA-N |
| XLogP | -1.75 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |