C26H20ClN5 — CID 130217525
9-[6-(6-chloro-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)-3-pyridinyl]carbazole (PubChem CID 130217525) has the molecular formula C26H20ClN5 and a molecular weight of 437.93 g/mol. Its IUPAC name is 9-[6-(6-chloro-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)-3-pyridinyl]carbazole.
| Compound Name | 9-[6-(6-chloro-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)-3-pyridinyl]carbazole |
|---|---|
| PubChem CID | 130217525 |
| Molecular Formula | C26H20ClN5 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 9-[6-(6-chloro-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)-3-pyridinyl]carbazole |
| SMILES | ClC1=NC(c2ccccc2)NC(c2ccc(-n3c4ccccc4c4ccccc43)cn2)N1 |
| InChI | InChI=1S/C26H20ClN5/c27-26-30-24(17-8-2-1-3-9-17)29-25(31-26)21-15-14-18(16-28-21)32-22-12-6-4-10-19(22)20-11-5-7-13-23(20)32/h1-16,24-25,29H,(H,30,31) |
| InChIKey | LALSYNZJKDYTRN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|