C14H21N5O5 — CID 130217574
1,3-dimethyl-5-[6-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)hexyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 130217574) has the molecular formula C14H21N5O5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1,3-dimethyl-5-[6-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)hexyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[6-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)hexyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 130217574 |
| Molecular Formula | C14H21N5O5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1,3-dimethyl-5-[6-(3-methyl-2,4-dioxo-1,3-diazetidin-1-yl)hexyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(CCCCCCn2c(=O)n(C)c(=O)n(C)c2=O)C1=O |
| InChI | InChI=1S/C14H21N5O5/c1-15-10(20)16(2)12(22)18(11(15)21)8-6-4-5-7-9-19-13(23)17(3)14(19)24/h4-9H2,1-3H3 |
| InChIKey | WTFHPTAUFUEURP-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 106.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|