C13H22N6O7S — CID 130217583
[(2R)-2-[(3S)-3-amino-3-[5-[(1S)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]propyl]-5-oxopyrrolidin-1-yl] hydrogen sulfate (PubChem CID 130217583) has the molecular formula C13H22N6O7S and a molecular weight of 406.42 g/mol. Its IUPAC name is [(2R)-2-[(3S)-3-amino-3-[5-[(1S)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]propyl]-5-oxopyrrolidin-1-yl] hydrogen sulfate.
| Compound Name | [(2R)-2-[(3S)-3-amino-3-[5-[(1S)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]propyl]-5-oxopyrrolidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 130217583 |
| Molecular Formula | C13H22N6O7S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [(2R)-2-[(3S)-3-amino-3-[5-[(1S)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]propyl]-5-oxopyrrolidin-1-yl] hydrogen sulfate |
| SMILES | NC(N)=NC[C@H](O)c1cc([C@@H](N)CC[C@@H]2CCC(=O)N2OS(=O)(=O)O)no1 |
| InChI | InChI=1S/C13H22N6O7S/c14-8(9-5-11(25-18-9)10(20)6-17-13(15)16)3-1-7-2-4-12(21)19(7)26-27(22,23)24/h5,7-8,10,20H,1-4,6,14H2,(H4,15,16,17)(H,22,23,24)/t7-,8+,10+/m1/s1 |
| InChIKey | KXAIWTZFLNUTHK-WEDXCCLWSA-N |
| XLogP | -1.51 |
| TPSA | 220.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|