C9H13F2N — CID 130218533
N-[(3E,5E)-4,6-difluoro-2-methylhepta-3,5-dien-3-yl]methanimine (PubChem CID 130218533) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is N-[(3E,5E)-4,6-difluoro-2-methylhepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3E,5E)-4,6-difluoro-2-methylhepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 130218533 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N-[(3E,5E)-4,6-difluoro-2-methylhepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C(F)\C=C(/C)F)C(C)C |
| InChI | InChI=1S/C9H13F2N/c1-6(2)9(12-4)8(11)5-7(3)10/h5-6H,4H2,1-3H3/b7-5+,9-8+ |
| InChIKey | PZZOEBMHYOMTHI-ZIRGRKGMSA-N |
| XLogP | 3.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|