C11H18N2 — CID 130218593
1,3,4,7-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 130218593) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1,3,4,7-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | 1,3,4,7-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 130218593 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1,3,4,7-tetramethyl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | CC1=NC(C)C(C)=C2CCC(C)N12 |
| InChI | InChI=1S/C11H18N2/c1-7-5-6-11-8(2)9(3)12-10(4)13(7)11/h7,9H,5-6H2,1-4H3 |
| InChIKey | QDWWTBFELIRSCQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |