C19H25N3O3 — CID 130218679
(4R,8S)-2-[(4-methoxyphenyl)methyl]-6,8,9-trimethyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-4-carboxylic acid (PubChem CID 130218679) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (4R,8S)-2-[(4-methoxyphenyl)methyl]-6,8,9-trimethyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-4-carboxylic acid.
| Compound Name | (4R,8S)-2-[(4-methoxyphenyl)methyl]-6,8,9-trimethyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 130218679 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (4R,8S)-2-[(4-methoxyphenyl)methyl]-6,8,9-trimethyl-1,3,4,8-tetrahydropyrazino[1,2-c]pyrimidine-4-carboxylic acid |
| SMILES | COc1ccc(CN2CC3=C(C)[C@H](C)N=C(C)N3[C@@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-12-13(2)20-14(3)22-17(12)10-21(11-18(22)19(23)24)9-15-5-7-16(25-4)8-6-15/h5-8,13,18H,9-11H2,1-4H3,(H,23,24)/t13-,18+/m0/s1 |
| InChIKey | CPYQWDHVJAWBLA-SCLBCKFNSA-N |
| XLogP | 2.36 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |